Information card for entry 2226941
| Chemical name |
2-[(2<i>Z</i>,3<i>E</i>)-2-Hydroxyimino-5-phenyl-2,3-dihydro-3- thienylidene]-2-phenylacetonitrile |
| Formula |
C18 H12 N2 O S |
| Calculated formula |
C18 H12 N2 O S |
| SMILES |
S1C(c2ccccc2)=CC(/C1=N/O)=C(/C#N)c1ccccc1 |
| Title of publication |
2-[(2<i>Z</i>,3<i>E</i>)-2-Hydroxyimino-5-phenyl-2,3-dihydro-3-thienylidene]-2-phenylacetonitrile |
| Authors of publication |
Rad, Nazar; Teslenko, Yuri; Obushak, Mykola; Pavlyuk, Volodymyr; Marciniak, Bernard |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
8 |
| Pages of publication |
o1924 |
| a |
7.9826 ± 0.0005 Å |
| b |
21.34 ± 0.0007 Å |
| c |
8.7253 ± 0.0005 Å |
| α |
90° |
| β |
90.471 ± 0.007° |
| γ |
90° |
| Cell volume |
1486.29 ± 0.14 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0516 |
| Residual factor for significantly intense reflections |
0.0359 |
| Weighted residual factors for significantly intense reflections |
0.0987 |
| Weighted residual factors for all reflections included in the refinement |
0.1036 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2226941.html