Information card for entry 2227002
| Chemical name |
1,5-Dimethyl-2-phenyl-4-{[(<i>E</i>)-3,4,5-trimethoxybenzylidene]amino}- 1<i>H</i>-pyrazol-3(2<i>H</i>)-one |
| Formula |
C21 H23 N3 O4 |
| Calculated formula |
C21 H23 N3 O4 |
| SMILES |
n1(n(c(c(/N=C/c2cc(OC)c(OC)c(OC)c2)c1=O)C)C)c1ccccc1 |
| Title of publication |
1,5-Dimethyl-2-phenyl-4-{[(<i>E</i>)-3,4,5-trimethoxybenzylidene]amino}-1<i>H</i>-pyrazol-3(2<i>H</i>)-one |
| Authors of publication |
Liu, Shan-Bin; Bi, Cai-Feng; Fan, Yu-Hua; Zhang, Xia; Zhang, Dong-Mei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
8 |
| Pages of publication |
o2149 |
| a |
12.3644 ± 0.0012 Å |
| b |
14.0075 ± 0.0016 Å |
| c |
11.2682 ± 0.0011 Å |
| α |
90° |
| β |
96.468 ± 0.0001° |
| γ |
90° |
| Cell volume |
1939.2 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0787 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.087 |
| Weighted residual factors for all reflections included in the refinement |
0.0979 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.994 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227002.html