Information card for entry 2227059
| Chemical name |
<i>N</i>-[2-(3-Methyl-1-oxo-1,2-dihydropyrrolo[1,2-<i>a</i>]pyrazin-2-yl)ethyl]methanesulfonamide |
| Formula |
C11 H15 N3 O3 S |
| Calculated formula |
C11 H15 N3 O3 S |
| SMILES |
S(=O)(=O)(NCCn1c(=O)c2n(cc1C)ccc2)C |
| Title of publication |
<i>N</i>-[2-(3-Methyl-1-oxo-1,2-dihydropyrrolo[1,2-<i>a</i>]pyrazin-2-yl)ethyl]methanesulfonamide |
| Authors of publication |
Khan, Salman Tariq; Yu, Peng; Chantrapromma, Suchada; Afza, Nighat; Nelofar, Aisha |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
8 |
| Pages of publication |
o1957 |
| a |
5.492 ± 0.001 Å |
| b |
20.631 ± 0.004 Å |
| c |
11.212 ± 0.002 Å |
| α |
90° |
| β |
99.953 ± 0.006° |
| γ |
90° |
| Cell volume |
1251.3 ± 0.4 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0494 |
| Residual factor for significantly intense reflections |
0.0398 |
| Weighted residual factors for significantly intense reflections |
0.0988 |
| Weighted residual factors for all reflections included in the refinement |
0.1046 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227059.html