Information card for entry 2227274
| Chemical name |
Ethyl {4-[(1,5-dimethyl-2,4-dioxo-2,3,4,5-tetrahydro-1<i>H</i>-1,5- benzodiazepin-3-yl)methyl]-1,2,3-triazol-1-yl}acetate |
| Formula |
C18 H21 N5 O4 |
| Calculated formula |
C18 H21 N5 O4 |
| SMILES |
O=C1N(c2ccccc2N(C(=O)C1Cc1nnn(c1)CC(=O)OCC)C)C |
| Title of publication |
Ethyl {4-[(1,5-dimethyl-2,4-dioxo-2,3,4,5-tetrahydro-1<i>H</i>-1,5-benzodiazepin-3-yl)methyl]-1,2,3-triazol-1-yl}acetate |
| Authors of publication |
Dardouri, Rachida; Kandri Rodi, Youssef; Ladeira, Sonia; Essassi, El Mokhtar; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o3039 |
| a |
8.5452 ± 0.0002 Å |
| b |
15.9993 ± 0.0005 Å |
| c |
13.9215 ± 0.0004 Å |
| α |
90° |
| β |
106.853 ± 0.001° |
| γ |
90° |
| Cell volume |
1821.56 ± 0.09 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0723 |
| Residual factor for significantly intense reflections |
0.0449 |
| Weighted residual factors for significantly intense reflections |
0.1085 |
| Weighted residual factors for all reflections included in the refinement |
0.1239 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227274.html