Information card for entry 2227345
| Chemical name |
Trimethyl-3-methoxy-4-oxo-5-triphenylphosphoranylidenecyclopent-1-ene- 1,2,3-tricarboxylate |
| Formula |
C30 H27 O8 P |
| Calculated formula |
C30 H27 O8 P |
| SMILES |
P(=C1C(=O)C(OC)(C(=C1C(=O)OC)C(=O)OC)C(=O)OC)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Title of publication |
Trimethyl-3-methoxy-4-oxo-5-triphenylphosphoranylidenecyclopent-1-ene-1,2,3-tricarboxylate |
| Authors of publication |
Krawczyk, Krzysztof K.; Wojtasiewicz, Krystyna; Maurin, Jan K.; Gronowska, Ewa; Czarnocki, Zbigniew |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2792 |
| a |
10.922 ± 0.0001 Å |
| b |
15.1215 ± 0.0001 Å |
| c |
16.7423 ± 0.0001 Å |
| α |
90° |
| β |
92.145 ± 0.001° |
| γ |
90° |
| Cell volume |
2763.17 ± 0.04 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0667 |
| Residual factor for significantly intense reflections |
0.0474 |
| Weighted residual factors for significantly intense reflections |
0.1219 |
| Weighted residual factors for all reflections included in the refinement |
0.1294 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227345.html