Information card for entry 2227404
| Chemical name |
5-(2,3,4,5,6-Pentafluorophenyl)-1,3,4-thiadiazol-2-amine |
| Formula |
C8 H2 F5 N3 S |
| Calculated formula |
C8 H2 F5 N3 S |
| SMILES |
s1c(N)nnc1c1c(F)c(F)c(F)c(F)c1F |
| Title of publication |
5-(2,3,4,5,6-Pentafluorophenyl)-1,3,4-thiadiazol-2-amine |
| Authors of publication |
Wang, Peng; Wan, Rong; Zhang, Jianqiang; Yu, Peng; He, Qiu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2765 |
| a |
11.897 ± 0.002 Å |
| b |
7.068 ± 0.0014 Å |
| c |
11.553 ± 0.002 Å |
| α |
90° |
| β |
104.66 ± 0.03° |
| γ |
90° |
| Cell volume |
939.8 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0635 |
| Residual factor for significantly intense reflections |
0.0428 |
| Weighted residual factors for significantly intense reflections |
0.114 |
| Weighted residual factors for all reflections included in the refinement |
0.1277 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227404.html