Information card for entry 2227462
| Chemical name |
2,3-Dibromo-1-[4-(2,3-dibromo-4,5-dimethoxybenzyl)-2,5-dimethoxybenzyl]- 4,5-dimethoxybenzene |
| Formula |
C26 H26 Br4 O6 |
| Calculated formula |
C26 H26 Br4 O6 |
| SMILES |
COc1cc(Cc2cc(OC)c(c(c2Br)Br)OC)c(cc1Cc1cc(OC)c(c(c1Br)Br)OC)OC |
| Title of publication |
2,3-Dibromo-1-[4-(2,3-dibromo-4,5-dimethoxybenzyl)-2,5-dimethoxybenzyl]-4,5-dimethoxybenzene |
| Authors of publication |
Şahin, Ertan; Balaydın, Halis T.; Göksu, Süleyman; Menzek, Abdullah |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o3029 |
| a |
11.193 ± 0.005 Å |
| b |
9.645 ± 0.004 Å |
| c |
13.212 ± 0.005 Å |
| α |
90° |
| β |
107.125 ± 0.005° |
| γ |
90° |
| Cell volume |
1363.1 ± 1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0869 |
| Residual factor for significantly intense reflections |
0.0778 |
| Weighted residual factors for all reflections included in the refinement |
0.1253 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.452 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227462.html