Information card for entry 2227523
| Chemical name |
2-(3-Oxo-3,4-dihydro-2<i>H</i>-1,4-benzothiazin-4-yl)acetamide |
| Formula |
C10 H10 N2 O2 S |
| Calculated formula |
C10 H10 N2 O2 S |
| SMILES |
c12ccccc1N(C(=O)CS2)CC(=O)N |
| Title of publication |
2-(3-Oxo-3,4-dihydro-2<i>H</i>-1,4-benzothiazin-4-yl)acetamide |
| Authors of publication |
Saeed, Azher; Mahmood, Zaid; Yang, Shiyao; Salim, Muhammad; Akhtar, Muhammad Saleem |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
o2567 |
| a |
8.0652 ± 0.0006 Å |
| b |
4.8415 ± 0.0003 Å |
| c |
26.1517 ± 0.0019 Å |
| α |
90° |
| β |
94.798 ± 0.004° |
| γ |
90° |
| Cell volume |
1017.58 ± 0.12 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.071 |
| Residual factor for significantly intense reflections |
0.0393 |
| Weighted residual factors for significantly intense reflections |
0.0897 |
| Weighted residual factors for all reflections included in the refinement |
0.1067 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227523.html