Information card for entry 2227540
| Chemical name |
1,2,4,5-Tetrafluoro-3,6-diiodobenzene–4-(pyridin-4-ylsulfanyl)pyridine (1/1) |
| Formula |
C16 H8 F4 I2 N2 S |
| Calculated formula |
C16 H8 F4 I2 N2 S |
| SMILES |
n1ccc(cc1)Sc1ccncc1.Fc1c(I)c(F)c(c(c1F)I)F |
| Title of publication |
1,2,4,5-Tetrafluoro-3,6-diiodobenzene–4-(pyridin-4-ylsulfanyl)pyridine (1/1) |
| Authors of publication |
Arman, Hadi D.; Kaulgud, Trupta; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
o2683 |
| a |
13.804 ± 0.005 Å |
| b |
5.829 ± 0.002 Å |
| c |
22.164 ± 0.008 Å |
| α |
90° |
| β |
97.989 ± 0.007° |
| γ |
90° |
| Cell volume |
1766.1 ± 1.1 Å3 |
| Cell temperature |
98 ± 2 K |
| Ambient diffraction temperature |
98 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.036 |
| Residual factor for significantly intense reflections |
0.034 |
| Weighted residual factors for significantly intense reflections |
0.072 |
| Weighted residual factors for all reflections included in the refinement |
0.073 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227540.html