Information card for entry 2227603
| Chemical name |
Ethyl 7-(2-chlorophenyl)-5-trifluoromethyl-4,7-dihydro-1,2,4-triazolo[1,5-\ <i>a</i>]pyrimidine-6-carboxylate |
| Formula |
C15 H12 Cl F3 N4 O2 |
| Calculated formula |
C15 H12 Cl F3 N4 O2 |
| SMILES |
CCOC(=O)C1=C(Nc2n(C1c1ccccc1Cl)ncn2)C(F)(F)F |
| Title of publication |
Ethyl 7-(2-chlorophenyl)-5-trifluoromethyl-4,7-dihydro-1,2,4-triazolo[1,5-<i>a</i>]pyrimidine-6-carboxylate |
| Authors of publication |
Mou, Jie; Yu, Chen-Xia; Yao, Chang-Sheng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
o2642 |
| a |
9.8927 ± 0.0012 Å |
| b |
6.8055 ± 0.0006 Å |
| c |
24.403 ± 0.003 Å |
| α |
90° |
| β |
99.237 ± 0.009° |
| γ |
90° |
| Cell volume |
1621.6 ± 0.3 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.06 |
| Residual factor for significantly intense reflections |
0.0467 |
| Weighted residual factors for significantly intense reflections |
0.1118 |
| Weighted residual factors for all reflections included in the refinement |
0.1208 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.081 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227603.html