Information card for entry 2227737
| Chemical name |
Methyl 4-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Formula |
C19 H21 N O4 |
| Calculated formula |
C19 H21 N O4 |
| SMILES |
N1C2=C(C(=O)CCC2)C(C(=C1C)C(=O)OC)c1ccc(OC)cc1 |
| Title of publication |
Methyl 4-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Authors of publication |
Yang, Xiao-Hui; Zhou, Yong-Hong; Zhang, Meng; Song, Xing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2767 |
| a |
13.628 ± 0.003 Å |
| b |
8.63 ± 0.0017 Å |
| c |
14.577 ± 0.003 Å |
| α |
90° |
| β |
98.39 ± 0.03° |
| γ |
90° |
| Cell volume |
1696 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1817 |
| Residual factor for significantly intense reflections |
0.0696 |
| Weighted residual factors for significantly intense reflections |
0.0996 |
| Weighted residual factors for all reflections included in the refinement |
0.1277 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227737.html