Information card for entry 2227753
| Chemical name |
Dimethyl 4,4'-(pyridine-2,6-diyl)dibenzoate |
| Formula |
C21 H17 N O4 |
| Calculated formula |
C21 H17 N O4 |
| SMILES |
COC(=O)c1ccc(cc1)c1cccc(n1)c1ccc(cc1)C(=O)OC |
| Title of publication |
Dimethyl 4,4'-(pyridine-2,6-diyl)dibenzoate |
| Authors of publication |
Cui, Yue; Gao, Qian; Wang, Huan-Huan; Wang, Lin; Xie, Ya-Bo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2975 |
| a |
34.296 ± 0.01 Å |
| b |
7.401 ± 0.002 Å |
| c |
6.623 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1681.1 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
36 |
| Hermann-Mauguin space group symbol |
C m c 21 |
| Hall space group symbol |
C 2c -2 |
| Residual factor for all reflections |
0.0395 |
| Residual factor for significantly intense reflections |
0.0374 |
| Weighted residual factors for significantly intense reflections |
0.1062 |
| Weighted residual factors for all reflections included in the refinement |
0.1085 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227753.html