Information card for entry 2227775
| Common name |
2,3-diaminopyridinium sorbate |
| Chemical name |
2,3-Diaminopyridinium (2<i>E</i>,4<i>E</i>)-hexa-2,4-dienoate |
| Formula |
C11 H15 N3 O2 |
| Calculated formula |
C11 H15 N3 O2 |
| SMILES |
[O-]C(=O)/C=C/C=C/C.[nH+]1cccc(N)c1N |
| Title of publication |
2,3-Diaminopyridinium (2<i>E</i>,4<i>E</i>)-hexa-2,4-dienoate |
| Authors of publication |
Hemamalini, Madhukar; Fun, Hoong-Kun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
9 |
| Pages of publication |
o2369 |
| a |
9.044 ± 0.0003 Å |
| b |
10.6964 ± 0.0003 Å |
| c |
12.4632 ± 0.0004 Å |
| α |
90° |
| β |
94.947 ± 0.002° |
| γ |
90° |
| Cell volume |
1201.18 ± 0.06 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0936 |
| Residual factor for significantly intense reflections |
0.0494 |
| Weighted residual factors for significantly intense reflections |
0.0913 |
| Weighted residual factors for all reflections included in the refinement |
0.1105 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.023 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227775.html