Information card for entry 2227805
| Chemical name |
2,2'-Biimidazolium 5-amino-2,4,6-tribromoisophthalate |
| Formula |
C14 H10 Br3 N5 O4 |
| Calculated formula |
C14 H10 Br3 N5 O4 |
| SMILES |
Brc1c(C(=O)[O-])c(Br)c(N)c(Br)c1C(=O)[O-].[nH]1cc[nH+]c1c1[nH]cc[nH+]1 |
| Title of publication |
2,2'-Biimidazolium 5-amino-2,4,6-tribromoisophthalate |
| Authors of publication |
Zhang, Kou-Lin; Huang, Han; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2919 |
| a |
9.0525 ± 0.001 Å |
| b |
9.2043 ± 0.001 Å |
| c |
11.5252 ± 0.0012 Å |
| α |
90.262 ± 0.001° |
| β |
108.332 ± 0.001° |
| γ |
93.136 ± 0.001° |
| Cell volume |
909.96 ± 0.17 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0535 |
| Residual factor for significantly intense reflections |
0.0348 |
| Weighted residual factors for significantly intense reflections |
0.0904 |
| Weighted residual factors for all reflections included in the refinement |
0.1196 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.116 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227805.html