Information card for entry 2227835
| Chemical name |
<i>N</i>,<i>N</i>'-Dibenzyl-<i>N</i>''-(2,6-difluorobenzoyl)- <i>N</i>,<i>N</i>'-dimethylphosphoric triamide |
| Formula |
C23 H24 F2 N3 O2 P |
| Calculated formula |
C23 H24 F2 N3 O2 P |
| SMILES |
P(=O)(NC(=O)c1c(F)cccc1F)(N(Cc1ccccc1)C)N(Cc1ccccc1)C |
| Title of publication |
<i>N</i>,<i>N</i>'-Dibenzyl-<i>N</i>''-(2,6-difluorobenzoyl)-<i>N</i>,<i>N</i>'-dimethylphosphoric triamide |
| Authors of publication |
Pourayoubi, Mehrdad; Tarahhomi, Atekeh; Rheingold, Arnold L.; Golen, James A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
o2524 |
| a |
9.937 ± 0.0011 Å |
| b |
11.1093 ± 0.0015 Å |
| c |
11.5902 ± 0.0014 Å |
| α |
89.101 ± 0.004° |
| β |
67.826 ± 0.004° |
| γ |
71.664 ± 0.004° |
| Cell volume |
1116.9 ± 0.2 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.07 |
| Residual factor for significantly intense reflections |
0.0483 |
| Weighted residual factors for significantly intense reflections |
0.1153 |
| Weighted residual factors for all reflections included in the refinement |
0.1256 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227835.html