Information card for entry 2227856
| Chemical name |
Hexaaquacobalt(II) 4,4'-(1,2-dihydroxyethane-1,2-diyl)dibenzoate monohydrate |
| Formula |
C16 H26 Co O13 |
| Calculated formula |
C16 H26 Co O13 |
| SMILES |
C(=O)([O-])c1ccc(cc1)[C@@H]([C@@H](c1ccc(C(=O)[O-])cc1)O)O.[Co]([OH2])([OH2])([OH2])([OH2])([OH2])[OH2].O |
| Title of publication |
Hexaaquacobalt(II) 4,4'-(1,2-dihydroxyethane-1,2-diyl)dibenzoate monohydrate |
| Authors of publication |
Tang, Ping; Ma, Dan; Chen, Zhan-qing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
m1322 |
| a |
6.043 ± 0.0006 Å |
| b |
20.487 ± 0.002 Å |
| c |
8.6341 ± 0.0009 Å |
| α |
90° |
| β |
104.115 ± 0.001° |
| γ |
90° |
| Cell volume |
1036.65 ± 0.18 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
11 |
| Hermann-Mauguin space group symbol |
P 1 21/m 1 |
| Hall space group symbol |
-P 2yb |
| Residual factor for all reflections |
0.081 |
| Residual factor for significantly intense reflections |
0.0745 |
| Weighted residual factors for significantly intense reflections |
0.1744 |
| Weighted residual factors for all reflections included in the refinement |
0.1768 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.254 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227856.html