Information card for entry 2227880
| Chemical name |
(<i>E</i>)-1-(3,5-Difluorophenyl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| Formula |
C17 H14 F2 O3 |
| Calculated formula |
C17 H14 F2 O3 |
| SMILES |
COc1cc(OC)ccc1/C=C/C(=O)c1cc(F)cc(c1)F |
| Title of publication |
(<i>E</i>)-1-(3,5-Difluorophenyl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| Authors of publication |
Huang, Tanxiao; Zhang, Dongdong; Yang, Quanzhi; Wei, Xiaoyan; Wu, Jianzhang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
o2518 |
| a |
7.8047 ± 0.0008 Å |
| b |
11.2591 ± 0.0012 Å |
| c |
17.008 ± 0.0018 Å |
| α |
81.407 ± 0.002° |
| β |
81.231 ± 0.002° |
| γ |
76.319 ± 0.002° |
| Cell volume |
1425.1 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1029 |
| Residual factor for significantly intense reflections |
0.0567 |
| Weighted residual factors for significantly intense reflections |
0.1337 |
| Weighted residual factors for all reflections included in the refinement |
0.1621 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.917 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227880.html