Information card for entry 2227911
| Chemical name |
3-Phenyl-2-(pyrrolidin-1-yl)-5,6-dihydro-8<i>H</i>- thiopyrano[4',3':4,5]thieno[2,3-<i>d</i>]pyrimidin-4(3<i>H</i>)-one |
| Formula |
C19 H19 N3 O S2 |
| Calculated formula |
C19 H19 N3 O S2 |
| SMILES |
s1c2nc(n(c(=O)c2c2CCSCc12)c1ccccc1)N1CCCC1 |
| Title of publication |
3-Phenyl-2-(pyrrolidin-1-yl)-5,6-dihydro-8<i>H</i>-thiopyrano[4',3':4,5]thieno[2,3-<i>d</i>]pyrimidin-4(3<i>H</i>)-one |
| Authors of publication |
Meng, Shuang-Ming; Xie, Hai; Fan, Yue-Qin; Jing, Bu-qin; Guo, Yong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
9 |
| Pages of publication |
o2403 |
| a |
8.1484 ± 0.0008 Å |
| b |
9.3455 ± 0.0009 Å |
| c |
12.1834 ± 0.0012 Å |
| α |
73.668 ± 0.001° |
| β |
88.629 ± 0.001° |
| γ |
79.568 ± 0.001° |
| Cell volume |
875.26 ± 0.15 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0542 |
| Residual factor for significantly intense reflections |
0.0433 |
| Weighted residual factors for significantly intense reflections |
0.1098 |
| Weighted residual factors for all reflections included in the refinement |
0.1192 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227911.html