Information card for entry 2227941
| Chemical name |
5,7-Dihydroxy-3,6-dimethoxy-2-(4-methoxyphenyl)-4<i>H</i>-chromen-4-one monohydrate |
| Formula |
C18 H18 O8 |
| Calculated formula |
C18 H18 O8 |
| SMILES |
o1c2cc(O)c(OC)c(O)c2c(=O)c(OC)c1c1ccc(OC)cc1.O |
| Title of publication |
5,7-Dihydroxy-3,6-dimethoxy-2-(4-methoxyphenyl)-4<i>H</i>-chromen-4-one monohydrate |
| Authors of publication |
Mohammad, Akhtar; Anis, Itrat; McKee, Vickie; Frese, Josef W. A.; Shah, Muhammad Raza |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2716 - o2717 |
| a |
19.869 ± 0.004 Å |
| b |
6.8126 ± 0.0015 Å |
| c |
24.424 ± 0.005 Å |
| α |
90° |
| β |
91.298 ± 0.004° |
| γ |
90° |
| Cell volume |
3305.2 ± 1.2 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0958 |
| Residual factor for significantly intense reflections |
0.0499 |
| Weighted residual factors for significantly intense reflections |
0.1207 |
| Weighted residual factors for all reflections included in the refinement |
0.1417 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227941.html