Information card for entry 2227973
| Chemical name |
6-Butyl-5-(4-methylphenoxy)-3-phenyl-3<i>H</i>-1,2,3- triazolo[4,5-<i>d</i>]pyrimidin-7(6<i>H</i>)-one |
| Formula |
C21 H21 N5 O2 |
| Calculated formula |
C21 H21 N5 O2 |
| SMILES |
CCCCn1c(Oc2ccc(cc2)C)nc2c(c1=O)nnn2c1ccccc1 |
| Title of publication |
6-Butyl-5-(4-methylphenoxy)-3-phenyl-3<i>H</i>-1,2,3-triazolo[4,5-<i>d</i>]pyrimidin-7(6<i>H</i>)-one |
| Authors of publication |
Wang, Hong-Mei; Deng, Shou-Heng; Zeng, Xiao-Hua; Chen, Ping; Chen, Li-Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2990 - o2991 |
| a |
11.0954 ± 0.001 Å |
| b |
16.4478 ± 0.0015 Å |
| c |
11.3484 ± 0.0011 Å |
| α |
90° |
| β |
107.643 ± 0.001° |
| γ |
90° |
| Cell volume |
1973.6 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0719 |
| Residual factor for significantly intense reflections |
0.0541 |
| Weighted residual factors for significantly intense reflections |
0.172 |
| Weighted residual factors for all reflections included in the refinement |
0.1822 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2227973.html