Information card for entry 2228021
| Common name |
2,7-Dimethoxy-1,8-bis(4-phenoxybenzoyl)naphthalene |
| Chemical name |
[2,7-dimethoxy-8-(4-phenoxybenzoyl)naphthalen-1-yl](4-phenoxyphenyl)methanone |
| Formula |
C38 H28 O6 |
| Calculated formula |
C38 H28 O6 |
| SMILES |
O=C(c1c(OC)ccc2ccc(OC)c(c12)C(=O)c1ccc(Oc2ccccc2)cc1)c1ccc(Oc2ccccc2)cc1 |
| Title of publication |
2,7-Dimethoxy-1,8-bis(4-phenoxybenzoyl)naphthalene |
| Authors of publication |
Hijikata, Daichi; Takada, Teruhisa; Nagasawa, Atsushi; Okamoto, Akiko; Yonezawa, Noriyuki |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2902 - o2903 |
| a |
12.0733 ± 0.0004 Å |
| b |
12.4806 ± 0.0004 Å |
| c |
19.8094 ± 0.0006 Å |
| α |
90° |
| β |
91.115 ± 0.002° |
| γ |
90° |
| Cell volume |
2984.36 ± 0.16 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0392 |
| Residual factor for significantly intense reflections |
0.0355 |
| Weighted residual factors for significantly intense reflections |
0.0959 |
| Weighted residual factors for all reflections included in the refinement |
0.0989 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
1.54187 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228021.html