Information card for entry 2228035
| Chemical name |
2-(2-Nitroanilino)-4,5,6,7-tetrahydrobenzo[<i>b</i>]thiophene-3-carbonitrile |
| Formula |
C15 H13 N3 O2 S |
| Calculated formula |
C15 H13 N3 O2 S |
| SMILES |
c1(c(c2CCCCc2s1)C#N)Nc1ccccc1N(=O)=O |
| Title of publication |
2-(2-Nitroanilino)-4,5,6,7-tetrahydrobenzo[<i>b</i>]thiophene-3-carbonitrile |
| Authors of publication |
Mendonça Junior, Francisco J.B.; do Lima, Maria; Galdino, Suely L.; Pitta, Ivan R.; de Simone, Carlos A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
o2543 |
| a |
13.2764 ± 0.0004 Å |
| b |
13.4447 ± 0.0007 Å |
| c |
8.2237 ± 0.0004 Å |
| α |
90° |
| β |
106.794 ± 0.002° |
| γ |
90° |
| Cell volume |
1405.3 ± 0.11 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0781 |
| Residual factor for significantly intense reflections |
0.0572 |
| Weighted residual factors for significantly intense reflections |
0.1527 |
| Weighted residual factors for all reflections included in the refinement |
0.1741 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228035.html