Information card for entry 2228156
| Chemical name |
1-[(1,3-Dithiolan-2-yl)methyl]-6-methyl-8-nitro-1,2,3,5,6,7- hexahydroimidazo[1,2-<i>c</i>]pyrimidine |
| Formula |
C11 H18 N4 O2 S2 |
| Calculated formula |
C11 H18 N4 O2 S2 |
| SMILES |
C1(CN(C)CN2CCN(C=12)CC1SCCS1)N(=O)=O |
| Title of publication |
1-[(1,3-Dithiolan-2-yl)methyl]-6-methyl-8-nitro-1,2,3,5,6,7-hexahydroimidazo[1,2-<i>c</i>]pyrimidine |
| Authors of publication |
Tian, Zhongzhen; Dong, Haijun; Li, Dongmei; Wang, Gaolei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
9 |
| Pages of publication |
o2330 |
| a |
8.0326 ± 0.0007 Å |
| b |
9.3521 ± 0.0008 Å |
| c |
10.1109 ± 0.0009 Å |
| α |
80.461 ± 0.001° |
| β |
83.497 ± 0.001° |
| γ |
68.043 ± 0.001° |
| Cell volume |
693.62 ± 0.1 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0413 |
| Residual factor for significantly intense reflections |
0.0369 |
| Weighted residual factors for significantly intense reflections |
0.0945 |
| Weighted residual factors for all reflections included in the refinement |
0.0981 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228156.html