Information card for entry 2228193
| Chemical name |
6,7-Dihydro-5<i>H</i>-1,4-diazepino[1,2,3,4-<i>lmn</i>][1,10]phenanthroline- 4,8-diium tris(thiocyanato-κ<i>N</i>)cuprate(I) |
| Formula |
C18 H14 Cu N5 S3 |
| Calculated formula |
C18 H14 Cu N5 S3 |
| SMILES |
[Cu](N=C=S)(N=C=S)N=C=S.[n+]12cccc3ccc4ccc[n+](c4c13)CCC2 |
| Title of publication |
6,7-Dihydro-5<i>H</i>-1,4-diazepino[1,2,3,4-<i>lmn</i>][1,10]phenanthroline-4,8-diium tris(thiocyanato-κ<i>N</i>)cuprate(I) |
| Authors of publication |
Xu, Na; Niu, Yun-Yin; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
10 |
| Pages of publication |
m1280 |
| a |
17.2687 ± 0.0004 Å |
| b |
6.5825 ± 0.0002 Å |
| c |
17.2702 ± 0.0004 Å |
| α |
90° |
| β |
107.803 ± 0.002° |
| γ |
90° |
| Cell volume |
1869.12 ± 0.09 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0465 |
| Residual factor for significantly intense reflections |
0.0342 |
| Weighted residual factors for significantly intense reflections |
0.069 |
| Weighted residual factors for all reflections included in the refinement |
0.0745 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.994 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228193.html