Information card for entry 2228200
| Common name |
1,4-bis(5-phenyl-1,3,4-oxadiazol-2-ylsulfanyl)butane |
| Chemical name |
5,5'-diphenyl-2,2'-[butane-1,4-diylbis(sulfanediyl)]bis(1,3,4-oxadiazole) |
| Formula |
C20 H18 N4 O2 S2 |
| Calculated formula |
C20 H18 N4 O2 S2 |
| SMILES |
C(CSc1nnc(o1)c1ccccc1)CCSc1nnc(o1)c1ccccc1 |
| Title of publication |
5,5'-Diphenyl-2,2'-[butane-1,4-diylbis(sulfanediyl)]bis(1,3,4-oxadiazole) |
| Authors of publication |
Wang, Wei; Qiu, Hong; Gao, Yan; Yao, Hong-Guo; Ji, Ming |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
11 |
| Pages of publication |
o2931 |
| a |
12.202 ± 0.002 Å |
| b |
5.9317 ± 0.0012 Å |
| c |
13.518 ± 0.003 Å |
| α |
90° |
| β |
104.04 ± 0.03° |
| γ |
90° |
| Cell volume |
949.2 ± 0.3 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0501 |
| Residual factor for significantly intense reflections |
0.0403 |
| Weighted residual factors for significantly intense reflections |
0.1079 |
| Weighted residual factors for all reflections included in the refinement |
0.1279 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.098 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228200.html