Information card for entry 2228203
| Chemical name |
Diaquabis(3-nitrobenzoato-κ<i>O</i>^1^)bis[1<i>H</i>-5-(3-pyridyl)- 3-(4-pyridyl)-1<i>H</i>-1,2,4-triazole-κ<i>N</i>^5^]cobalt(II) dihydrate |
| Formula |
C38 H34 Co N12 O12 |
| Calculated formula |
C38 H34 Co N12 O12 |
| SMILES |
[OH2][Co]([n]1cc(ccc1)c1nc([nH]n1)c1ccncc1)([n]1cc(ccc1)c1nc([nH]n1)c1ccncc1)(OC(=O)c1cccc(c1)N(=O)=O)(OC(=O)c1cccc(c1)N(=O)=O)[OH2].O.O |
| Title of publication |
Diaquabis(3-nitrobenzoato-κ<i>O</i>^1^)bis[1<i>H</i>-5-(3-pyridyl)-3-(4-pyridyl)-1<i>H</i>-1,2,4-triazole-κ<i>N</i>^5^]cobalt(II) dihydrate |
| Authors of publication |
Zhang, Yun-Liang; Liu, Ti-Lou; Sun, Shuang-Jiao; Li, Jie-Hong; Wu, Shi-Qing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
m1588 |
| a |
8.708 ± 0.0017 Å |
| b |
9.85 ± 0.002 Å |
| c |
12.488 ± 0.003 Å |
| α |
81.97 ± 0.03° |
| β |
85.74 ± 0.03° |
| γ |
71.36 ± 0.03° |
| Cell volume |
1004.5 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0911 |
| Residual factor for significantly intense reflections |
0.0632 |
| Weighted residual factors for significantly intense reflections |
0.1327 |
| Weighted residual factors for all reflections included in the refinement |
0.1462 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228203.html