Information card for entry 2228222
| Common name |
carbazole |
| Chemical name |
(<i>E</i>)-6-Chloro-2-(furan-2-ylmethylidene)-2,3,4,9-tetrahydro- 1<i>H</i>-carbazol-1-one |
| Formula |
C17 H12 Cl N O2 |
| Calculated formula |
C17 H12 Cl N O2 |
| SMILES |
Clc1cc2c3CCC(=C\c4occc4)/C(=O)c3[nH]c2cc1 |
| Title of publication |
(<i>E</i>)-6-Chloro-2-(furan-2-ylmethylidene)-2,3,4,9-tetrahydro-1<i>H</i>-carbazol-1-one |
| Authors of publication |
Archana, R.; Yamuna, E.; Rajendra Prasad, K. J.; Thiruvalluvar, A.; Butcher, R. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
o3198 |
| a |
15.0985 ± 0.0002 Å |
| b |
6.1553 ± 0.0001 Å |
| c |
15.3887 ± 0.0002 Å |
| α |
90° |
| β |
104.319 ± 0.001° |
| γ |
90° |
| Cell volume |
1385.73 ± 0.03 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.049 |
| Residual factor for significantly intense reflections |
0.0473 |
| Weighted residual factors for significantly intense reflections |
0.1369 |
| Weighted residual factors for all reflections included in the refinement |
0.1392 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.099 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228222.html