Information card for entry 2228241
| Chemical name |
3,4,7-Trimethyl-2-(4-methylphenyl)-2<i>H</i>-pyrazolo[3,4-<i>d</i>]pyridazin- 5-ium thiocyanate |
| Formula |
C16 H17 N5 S |
| Calculated formula |
C16 H17 N5 S |
| SMILES |
[S-]C#N.[nH+]1nc(C)c2nn(c(c2c1C)C)c1ccc(cc1)C |
| Title of publication |
3,4,7-Trimethyl-2-(4-methylphenyl)-2<i>H</i>-pyrazolo[3,4-<i>d</i>]pyridazin-5-ium thiocyanate |
| Authors of publication |
Abdel-Aziz, Hatem A.; Bari, Ahmed; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
o3344 |
| a |
18.2445 ± 0.0005 Å |
| b |
7.3341 ± 0.0002 Å |
| c |
24.2396 ± 0.0008 Å |
| α |
90° |
| β |
106.121 ± 0.003° |
| γ |
90° |
| Cell volume |
3115.89 ± 0.17 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0448 |
| Residual factor for significantly intense reflections |
0.0354 |
| Weighted residual factors for significantly intense reflections |
0.0886 |
| Weighted residual factors for all reflections included in the refinement |
0.0955 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.002 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228241.html