Information card for entry 2228273
| Chemical name |
<i>trans</i>-Bis(4,7-diphenyl-1,10-phenanthroline- κ^2^<i>N</i>,<i>N'</i>)bis(nitrato-κ^2^<i>O</i>,<i>O'</i>)zinc(II) |
| Formula |
C48 H32 N6 O6 Zn |
| Calculated formula |
C48 H32 N6 O6 Zn |
| SMILES |
c1cc(c2c3[n]1[Zn]1([n]4c3c(cc2)c(cc4)c2ccccc2)[n]2c3c4c(c(cc[n]14)c1ccccc1)ccc3c(cc2)c1ccccc1)c1ccccc1.N(=O)(=O)[O-].N(=O)(=O)[O-] |
| Title of publication |
<i>trans</i>-Bis(4,7-diphenyl-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')bis(nitrato-κ^2^<i>O</i>,<i>O</i>')zinc(II) |
| Authors of publication |
Fernandes, José A.; Almeida Paz, Filipe A.; Liu, Feng-Yi; Cunha-Silva, Luís; Carlos, Luís D.; Rocha, João |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
m1608 - m1609 |
| a |
20.5074 ± 0.0004 Å |
| b |
17.4116 ± 0.0003 Å |
| c |
12.7089 ± 0.0003 Å |
| α |
90° |
| β |
124.035 ± 0.001° |
| γ |
90° |
| Cell volume |
3760.56 ± 0.14 Å3 |
| Cell temperature |
180 ± 2 K |
| Ambient diffraction temperature |
180 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0339 |
| Residual factor for significantly intense reflections |
0.0286 |
| Weighted residual factors for significantly intense reflections |
0.0741 |
| Weighted residual factors for all reflections included in the refinement |
0.0767 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228273.html