Information card for entry 2228318
| Chemical name |
[<i>N</i>,<i>N</i>'-Bis(3-methoxy-2-oxidobenzylidene)cyclohexane-1,2-diaminium- κ^4^<i>O</i>,<i>O</i>',<i>O</i>'',<i>O</i>''']tris(nitrato- κ^2^<i>O</i>,<i>O</i>')europium(III) methanol monosolvate |
| Formula |
C23 H30 Eu N5 O14 |
| Calculated formula |
C23 H30 Eu N5 O14 |
| SMILES |
[Eu]123456([O]=c9c([O]1C)cccc9=CN[C@H]1CCCC[C@H]1NC=c1cccc([O]3C)c1=[O]2)(ON(=O)=[O]4)(ON(=O)=[O]5)[O]=N(=O)O6.OC |
| Title of publication |
[<i>N</i>,<i>N</i>'-Bis(3-methoxy-2-oxidobenzylidene)cyclohexane-1,2-diaminium-κ^4^<i>O</i>,<i>O</i>',<i>O</i>'',<i>O</i>''']tris(nitrato-κ^2^<i>O</i>,<i>O</i>')europium(III) methanol monosolvate |
| Authors of publication |
Yan, Peng-Fei; Bao, Yan; Li, Guang-Ming; Li, Jing-Ya; Chen, Peng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
m1650 |
| a |
9.7718 ± 0.0004 Å |
| b |
12.856 ± 0.0006 Å |
| c |
13.0567 ± 0.0006 Å |
| α |
78.798 ± 0.001° |
| β |
68.492 ± 0.001° |
| γ |
81.671 ± 0.001° |
| Cell volume |
1492.09 ± 0.12 Å3 |
| Cell temperature |
291 ± 2 K |
| Ambient diffraction temperature |
291 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0294 |
| Residual factor for significantly intense reflections |
0.025 |
| Weighted residual factors for significantly intense reflections |
0.065 |
| Weighted residual factors for all reflections included in the refinement |
0.0675 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228318.html