Information card for entry 2228486
| Chemical name |
2,2-Difluoro-4-phenyl-1,3,2-dioxaborolo[4,5-<i>c</i>]chromen-5-ium-2-ide |
| Formula |
C15 H9 B F2 O3 |
| Calculated formula |
C15 H9 B F2 O3 |
| SMILES |
[B]1(OC2=C(c3ccccc3)Oc3c(C2=[O]1)cccc3)(F)F |
| Title of publication |
2,2-Difluoro-4-phenyl-1,3,2-dioxaborolo[4,5-<i>c</i>]chromen-5-ium-2-ide |
| Authors of publication |
Wera, Michał; Roshal, Alexander D.; Błażejowski, Jerzy |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
o3354 - o3355 |
| a |
7.1969 ± 0.001 Å |
| b |
9.7054 ± 0.0011 Å |
| c |
9.9986 ± 0.0015 Å |
| α |
74.31 ± 0.011° |
| β |
75.931 ± 0.013° |
| γ |
71.296 ± 0.011° |
| Cell volume |
627.43 ± 0.16 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1256 |
| Residual factor for significantly intense reflections |
0.0582 |
| Weighted residual factors for significantly intense reflections |
0.2217 |
| Weighted residual factors for all reflections included in the refinement |
0.2335 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.097 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228486.html