Information card for entry 2228492
| Chemical name |
4-(4-Pyridyl)pyridinium 3-amino-5-carboxy-2,4,6-triiodobenzoate–5-amino-2,4,6-triiodoisophthalic acid (1/1) |
| Formula |
C26 H16 I6 N4 O8 |
| Calculated formula |
C26 H16 I6 N4 O8 |
| SMILES |
Ic1c(C(=O)[O-])c(I)c(N)c(I)c1C(=O)O.Ic1c(C(=O)O)c(I)c(N)c(I)c1C(=O)O.[nH+]1ccc(cc1)c1ccncc1 |
| Title of publication |
4-(4-Pyridyl)pyridinium 3-amino-5-carboxy-2,4,6-triiodobenzoate–5-amino-2,4,6-triiodoisophthalic acid (1/1) |
| Authors of publication |
Zhang, Kou-Lin; Diao, Guo-Wang; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
o3165 |
| a |
7.7388 ± 0.0004 Å |
| b |
34.2377 ± 0.0019 Å |
| c |
13.0739 ± 0.0007 Å |
| α |
90° |
| β |
106.506 ± 0.001° |
| γ |
90° |
| Cell volume |
3321.3 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0406 |
| Residual factor for significantly intense reflections |
0.0321 |
| Weighted residual factors for significantly intense reflections |
0.0781 |
| Weighted residual factors for all reflections included in the refinement |
0.082 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228492.html