Information card for entry 2228577
| Chemical name |
3',7',7'-Trimethyl-1'-phenyl-5',6',7',8'-tetrahydrospiro[indoline- 3,4'-(1<i>H</i>,4<i>H</i>-pyrazolo[3,4-<i>b</i>]chromene)]-2,5'-dione |
| Formula |
C26 H23 N3 O3 |
| Calculated formula |
C26 H23 N3 O3 |
| SMILES |
c1(c2c(n(c3ccccc3)n1)OC1=C(C32C(=O)Nc2c3cccc2)C(=O)CC(C1)(C)C)C |
| Title of publication |
3',7',7'-Trimethyl-1'-phenyl-5',6',7',8'-tetrahydrospiro[indoline-3,4'-(1<i>H</i>,4<i>H</i>-pyrazolo[3,4-<i>b</i>]chromene)]-2,5'-dione |
| Authors of publication |
Zhao, Li-Qin; Li, Bin; Li, Yi-Qun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
o3115 |
| a |
11.8778 ± 0.0019 Å |
| b |
12.891 ± 0.002 Å |
| c |
14.039 ± 0.002 Å |
| α |
90° |
| β |
100.28 ± 0.003° |
| γ |
90° |
| Cell volume |
2115.1 ± 0.6 Å3 |
| Cell temperature |
110 ± 2 K |
| Ambient diffraction temperature |
110 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0563 |
| Residual factor for significantly intense reflections |
0.0387 |
| Weighted residual factors for significantly intense reflections |
0.093 |
| Weighted residual factors for all reflections included in the refinement |
0.1024 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228577.html