Information card for entry 2228703
| Chemical name |
Bis(2,6-dihydroxybenzoato-κ^2^<i>O</i>^1^,<i>O</i>^1'^)(nitrato- κ^2^<i>O</i>,<i>O</i>')bis(1,10-phenanthroline- κ^2^<i>N</i>,<i>N</i>')praseodymium(III) |
| Formula |
C38 H26 N5 O11 Pr |
| Calculated formula |
C38 H26 N5 O11 Pr |
| SMILES |
[Pr]12345([O]=C(O1)c1c(O)cccc1O)([O]=C(O2)c1c(O)cccc1O)(ON(=[O]3)=O)([n]1cccc2c1c1[n]4cccc1cc2)[n]1cccc2c1c1[n]5cccc1cc2 |
| Title of publication |
Bis(2,6-dihydroxybenzoato-κ^2^<i>O</i>^1^,<i>O</i>^1'^)(nitrato-κ^2^<i>O</i>,<i>O</i>')bis(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')praseodymium(III) |
| Authors of publication |
Wang, Chiya; Gu, Xiaojin; Wang, Xinqing; Jin, Hongxiao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
m5 |
| a |
11.2738 ± 0.0002 Å |
| b |
26.8015 ± 0.0005 Å |
| c |
14.3886 ± 0.0004 Å |
| α |
90° |
| β |
127.934 ± 0.001° |
| γ |
90° |
| Cell volume |
3429.02 ± 0.14 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0379 |
| Residual factor for significantly intense reflections |
0.0349 |
| Weighted residual factors for significantly intense reflections |
0.0737 |
| Weighted residual factors for all reflections included in the refinement |
0.0748 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.234 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228703.html