Information card for entry 2228720
| Chemical name |
(1<i>S</i>,2<i>R</i>,4<i>S</i>)-1-[(Benzylamino)methyl]-4-(prop-1-en-2- yl)cyclohexane-1,2-diol |
| Formula |
C17 H25 N O2 |
| Calculated formula |
C17 H25 N O2 |
| SMILES |
O[C@]1([C@H](O)C[C@H](CC1)C(=C)C)CNCc1ccccc1 |
| Title of publication |
(1<i>S</i>,2<i>R</i>,4<i>S</i>)-1-[(Benzylamino)methyl]-4-(prop-1-en-2-yl)cyclohexane-1,2-diol |
| Authors of publication |
Outouch, Rachid; Boualy, Brahim; Ali, Mustapha Ait; Firdoussi, Larbi El; Rizzoli, Corrado |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
o195 - o196 |
| a |
5.8281 ± 0.0004 Å |
| b |
24.5421 ± 0.0016 Å |
| c |
5.8776 ± 0.0004 Å |
| α |
90° |
| β |
105.908 ± 0.004° |
| γ |
90° |
| Cell volume |
808.5 ± 0.1 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.033 |
| Residual factor for significantly intense reflections |
0.0314 |
| Weighted residual factors for significantly intense reflections |
0.0905 |
| Weighted residual factors for all reflections included in the refinement |
0.0919 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.082 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228720.html