Information card for entry 2228744
| Chemical name |
4,4-Dimethyl-3,4-dihydropyrido[2',3':3,4]pyrazolo[1,5-<i>a</i>][1,3,5]triazin- 2-amine ethanol monosolvate |
| Formula |
C12 H18 N6 O |
| Calculated formula |
C12 H18 N6 O |
| SMILES |
NC1=Nc2n(C(N1)(C)C)nc1c2cccn1.CCO |
| Title of publication |
4,4-Dimethyl-3,4-dihydropyrido[2',3':3,4]pyrazolo[1,5-<i>a</i>][1,3,5]triazin-2-amine ethanol monosolvate |
| Authors of publication |
Dolzhenko, Anton V.; Tan, Geok Kheng; Dolzhenko, Anna V.; Koh, Lip Lin; Chui, Wai Keung |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
o83 - o84 |
| a |
12.125 ± 0.0019 Å |
| b |
13.913 ± 0.002 Å |
| c |
16.598 ± 0.003 Å |
| α |
90° |
| β |
101.683 ± 0.004° |
| γ |
90° |
| Cell volume |
2742 ± 0.8 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0586 |
| Residual factor for significantly intense reflections |
0.0498 |
| Weighted residual factors for significantly intense reflections |
0.1279 |
| Weighted residual factors for all reflections included in the refinement |
0.1332 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228744.html