Information card for entry 2228767
| Common name |
N-benzyl-acid |
| Chemical name |
(3<i>S</i>)-2-Benzyl-3-carboxy-1,2,3,4-tetrahydroisoquinolinium chloride monohydrate |
| Formula |
C17 H20 Cl N O3 |
| Calculated formula |
C17 H20 Cl N O3 |
| SMILES |
[Cl-].O=C(O)[C@H]1[NH+](Cc2ccccc2C1)Cc1ccccc1.O |
| Title of publication |
(3<i>S</i>)-2-Benzyl-3-carboxy-1,2,3,4-tetrahydroisoquinolinium chloride monohydrate |
| Authors of publication |
Naicker, Tricia; Govender, Thavendran; Kruger, Hendrik G.; Maguire, Glenn E. M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
o228 |
| a |
8.6159 ± 0.0008 Å |
| b |
10.067 ± 0.0009 Å |
| c |
10.1392 ± 0.0009 Å |
| α |
90° |
| β |
108.686 ± 0.002° |
| γ |
90° |
| Cell volume |
833.08 ± 0.13 Å3 |
| Cell temperature |
193 ± 2 K |
| Ambient diffraction temperature |
193 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0491 |
| Residual factor for significantly intense reflections |
0.0364 |
| Weighted residual factors for significantly intense reflections |
0.0764 |
| Weighted residual factors for all reflections included in the refinement |
0.0819 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.035 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228767.html