Information card for entry 2228818
| Common name |
3,3'-(1,2-ethanediyldinitrilo)bis(2-butanone) dioxime |
| Chemical name |
3,8-Dimethyl-4,7-diazadeca-3,7-diene-2,9-dione dioxime |
| Formula |
C10 H18 N4 O2 |
| Calculated formula |
C10 H18 N4 O2 |
| SMILES |
O/N=C(/C(=N/CC/N=C(/C(=N/O)C)C)C)C |
| Title of publication |
3,8-Dimethyl-4,7-diazadeca-3,7-diene-2,9-dione dioxime |
| Authors of publication |
Achiwawanich, Supakit; Duangtongyou, Tanwawan; Pakawatchai, Chaveng; Siripaisarnpipat, Sutatip |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
o135 |
| a |
4.4128 ± 0.0003 Å |
| b |
12.8534 ± 0.0008 Å |
| c |
10.486 ± 0.0007 Å |
| α |
90° |
| β |
90.762 ± 0.002° |
| γ |
90° |
| Cell volume |
594.71 ± 0.07 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0706 |
| Residual factor for significantly intense reflections |
0.0485 |
| Weighted residual factors for significantly intense reflections |
0.1205 |
| Weighted residual factors for all reflections included in the refinement |
0.1316 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228818.html