Information card for entry 2228952
| Chemical name |
5-[(2-Chloro-4-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Formula |
C13 H11 Cl N2 O6 |
| Calculated formula |
C13 H11 Cl N2 O6 |
| SMILES |
Clc1cc(N(=O)=O)ccc1NC=C1C(=O)OC(OC1=O)(C)C |
| Title of publication |
5-[(2-Chloro-4-nitroanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Authors of publication |
Lan, Xian-Qiu; Zhang, Xiao-Feng; Yang, Ying-Hong; Luo, You-Fu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o392 |
| a |
13.585 ± 0.0005 Å |
| b |
5.04379 ± 0.00014 Å |
| c |
21.0272 ± 0.0007 Å |
| α |
90° |
| β |
104.427 ± 0.004° |
| γ |
90° |
| Cell volume |
1395.35 ± 0.08 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0609 |
| Residual factor for significantly intense reflections |
0.0413 |
| Weighted residual factors for significantly intense reflections |
0.0919 |
| Weighted residual factors for all reflections included in the refinement |
0.1042 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.036 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228952.html