Information card for entry 2228961
| Chemical name |
Diethyl 1,1-dioxo-3,5-bis(pyridin-2-yl)-1λ^6^,4-thiomorpholine-2,6-dicarboxylate |
| Formula |
C20 H23 N3 O6 S |
| Calculated formula |
C20 H23 N3 O6 S |
| SMILES |
CCOC(=O)[C@H]1[C@H](N[C@H]([C@@H](S1(=O)=O)C(=O)OCC)c1ccccn1)c1ccccn1.CCOC(=O)[C@@H]1[C@@H](N[C@@H]([C@H](S1(=O)=O)C(=O)OCC)c1ccccn1)c1ccccn1 |
| Title of publication |
Diethyl 1,1-dioxo-3,5-bis(pyridin-2-yl)-1λ^6^,4-thiomorpholine-2,6-dicarboxylate |
| Authors of publication |
Sugumar, P.; Edayadulla, N.; Ramesh, P.; Ramesh, P.; Ponnuswamy, M. N. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o305 |
| a |
20.7258 ± 0.0013 Å |
| b |
8.3921 ± 0.0005 Å |
| c |
24.4923 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
4260 ± 0.5 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0631 |
| Residual factor for significantly intense reflections |
0.0415 |
| Weighted residual factors for significantly intense reflections |
0.1005 |
| Weighted residual factors for all reflections included in the refinement |
0.1128 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228961.html