Information card for entry 2229107
| Chemical name |
1-Isobutyl-<i>N</i>,<i>N</i>-dimethyl-1<i>H</i>- imidazo[4,5-<i>c</i>]quinolin-4-amine |
| Formula |
C16 H20 N4 |
| Calculated formula |
C16 H20 N4 |
| SMILES |
n1c(N(C)C)c2ncn(c2c2c1cccc2)CC(C)C |
| Title of publication |
1-Isobutyl-<i>N</i>,<i>N</i>-dimethyl-1<i>H</i>-imidazo[4,5-<i>c</i>]quinolin-4-amine |
| Authors of publication |
Loh, Wan-Sin; Fun, Hoong-Kun; Kayarmar, Reshma; Viveka, S.; Nagaraja, G. K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o405 |
| a |
9.2804 ± 0.0002 Å |
| b |
18.5492 ± 0.0006 Å |
| c |
8.5147 ± 0.0002 Å |
| α |
90° |
| β |
101.051 ± 0.002° |
| γ |
90° |
| Cell volume |
1438.57 ± 0.07 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0915 |
| Residual factor for significantly intense reflections |
0.055 |
| Weighted residual factors for significantly intense reflections |
0.1272 |
| Weighted residual factors for all reflections included in the refinement |
0.1456 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229107.html