Information card for entry 2229121
| Chemical name |
Chloridobis(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(I) dichloridocopper(II) |
| Formula |
C24 H16 Cl3 Cu2 N4 |
| Calculated formula |
C24 H16 Cl3 Cu2 N4 |
| SMILES |
[Cu]12(Cl)([n]3cccc4ccc5ccc[n]1c5c34)[n]1cccc3ccc4ccc[n]2c4c13.[Cu]([Cl-])Cl |
| Title of publication |
Chloridobis(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(I) dichloridocopper(II) |
| Authors of publication |
Meng, Qingfen; Chen, Yanmei; Li, Bing; Chen, Sanping; Gao, Shengli |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
m226 |
| a |
9.8137 ± 0.0003 Å |
| b |
17.8813 ± 0.0006 Å |
| c |
26.2679 ± 0.0007 Å |
| α |
90° |
| β |
90.535 ± 0.001° |
| γ |
90° |
| Cell volume |
4609.3 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0658 |
| Residual factor for significantly intense reflections |
0.0375 |
| Weighted residual factors for significantly intense reflections |
0.0781 |
| Weighted residual factors for all reflections included in the refinement |
0.0896 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229121.html