Information card for entry 2229242
| Chemical name |
16-Isopropyl-5,9-dimethyltetracyclo[10.2.2.0^1,10^.0^4,9^] hexadec-15-ene-5,14-dimethanol |
| Formula |
C23 H38 O2 |
| Calculated formula |
C23 H38 O2 |
| SMILES |
OC[C@@H]1C[C@H]2C[C@H]3[C@]1(CC[C@@H]1[C@]3(C)CCC[C@@]1(C)CO)C=C2C(C)C |
| Title of publication |
16-Isopropyl-5,9-dimethyltetracyclo[10.2.2.0^1,10^.0^4,9^]hexadec-15-ene-5,14-dimethanol |
| Authors of publication |
Li, Jian; Rao, Xiao-ping; Shang, Shi-bin; Gao, Yanqing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o359 |
| a |
12.986 ± 0.003 Å |
| b |
25.583 ± 0.005 Å |
| c |
14.292 ± 0.003 Å |
| α |
90° |
| β |
116.19 ± 0.03° |
| γ |
90° |
| Cell volume |
4260.6 ± 1.9 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.1132 |
| Residual factor for significantly intense reflections |
0.0564 |
| Weighted residual factors for significantly intense reflections |
0.1257 |
| Weighted residual factors for all reflections included in the refinement |
0.1601 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.004 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229242.html