Information card for entry 2229286
| Common name |
Triamcinolone acetonide acetate |
| Chemical name |
2-(4b-Fluoro-5-hydroxy-4a,6a,8,8-tetramethyl-2-oxo- 2,4a,4b,5,6,6a,9a,10,10a,10b,11,12-dodecahydro-7,9-dioxa- pentaleno[2,1-<i>a</i>]phenanthren-6b-yl)-2-oxoethyl acetate |
| Formula |
C26 H33 F O7 |
| Calculated formula |
C26 H33 F O7 |
| SMILES |
F[C@]12[C@@H](CCC3=CC(=O)C=C[C@]13C)[C@H]1[C@@](C[C@@H]2O)(C)[C@@]2(OC(O[C@@H]2C1)(C)C)C(=O)COC(=O)C |
| Title of publication |
Triamcinolone acetonide acetate |
| Authors of publication |
Lu, Xiao; Tang, Gu-Ping; Gu, Jian-Ming; Hu, Xiu-Rong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o360 |
| a |
7.546 ± 0.0007 Å |
| b |
14.8102 ± 0.0004 Å |
| c |
11.5773 ± 0.0003 Å |
| α |
90° |
| β |
109.905 ± 0.001° |
| γ |
90° |
| Cell volume |
1216.56 ± 0.12 Å3 |
| Cell temperature |
296 ± 1 K |
| Ambient diffraction temperature |
296 ± 1 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0465 |
| Residual factor for significantly intense reflections |
0.035 |
| Weighted residual factors for significantly intense reflections |
0.0851 |
| Weighted residual factors for all reflections included in the refinement |
0.0997 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229286.html