Information card for entry 2229351
| Chemical name |
1-(2-Benzoyl-1-phenylethyl)-4-[(2-hydroxy-1-naphthyl)methylideneamino]- 3-phenyl-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Formula |
C34 H26 N4 O2 S |
| Calculated formula |
C34 H26 N4 O2 S |
| SMILES |
S=C1N(N=C(N1/N=C/c1c2ccccc2ccc1O)c1ccccc1)C(c1ccccc1)CC(=O)c1ccccc1 |
| Title of publication |
1-(2-Benzoyl-1-phenylethyl)-4-[(2-hydroxy-1-naphthyl)methylideneamino]-3-phenyl-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Authors of publication |
Wang, Wei; Yao, Hong-guo; Gao, Yan; Zhang, Jing-jing; Jia, Xiao-yu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
3 |
| Pages of publication |
o675 |
| a |
13.142 ± 0.003 Å |
| b |
21.563 ± 0.004 Å |
| c |
10.097 ± 0.002 Å |
| α |
90° |
| β |
99.22 ± 0.03° |
| γ |
90° |
| Cell volume |
2824.3 ± 1 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0599 |
| Residual factor for significantly intense reflections |
0.0446 |
| Weighted residual factors for significantly intense reflections |
0.1144 |
| Weighted residual factors for all reflections included in the refinement |
0.1423 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.11 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229351.html