Information card for entry 2229367
| Chemical name |
4-[(1,3-Dioxo-2,3-dihydro-1<i>H</i>-benzo[<i>de</i>]isoquinolin-2-yl)methyl]- <i>N</i>'-[(<i>E</i>)-4-nitrobenzylidene]benzenesulfonohydrazide dimethyl sulfoxide monosolvate |
| Formula |
C28 H24 N4 O7 S2 |
| Calculated formula |
C28 H24 N4 O7 S2 |
| SMILES |
S(=O)(=O)(N/N=C/c1ccc(cc1)N(=O)=O)c1ccc(CN2C(=O)c3cccc4cccc(c34)C2=O)cc1.S(=O)(C)C |
| Title of publication |
4-[(1,3-Dioxo-2,3-dihydro-1<i>H</i>-benzo[<i>de</i>]isoquinolin-2-yl)methyl]-<i>N</i>'-[(<i>E</i>)-4-nitrobenzylidene]benzenesulfonohydrazide dimethyl sulfoxide monosolvate |
| Authors of publication |
Bortoluzzi, Adailton J.; Policarpi, Everton B.; Mora, Cristiano; Oliveira, Kely N.; Nunes, Ricardo J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
3 |
| Pages of publication |
o627 - o628 |
| a |
9.152 ± 0.001 Å |
| b |
11.971 ± 0.001 Å |
| c |
13.91 ± 0.001 Å |
| α |
107.268 ± 0.007° |
| β |
101.789 ± 0.007° |
| γ |
96.319 ± 0.008° |
| Cell volume |
1400.6 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1046 |
| Residual factor for significantly intense reflections |
0.0524 |
| Weighted residual factors for significantly intense reflections |
0.138 |
| Weighted residual factors for all reflections included in the refinement |
0.1626 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229367.html