Information card for entry 2229416
| Chemical name |
Ethyl 1-benzoyl-4-hydroxy-2,6-diphenyl-1,2,5,6-tetrahydropyridine-3-carboxylate |
| Formula |
C27 H25 N O4 |
| Calculated formula |
C27 H25 N O4 |
| SMILES |
[C@@H]1(CC(=C([C@@H](c2ccccc2)N1C(=O)c1ccccc1)C(=O)OCC)O)c1ccccc1.[C@H]1(CC(=C([C@H](c2ccccc2)N1C(=O)c1ccccc1)C(=O)OCC)O)c1ccccc1 |
| Title of publication |
Ethyl 1-benzoyl-4-hydroxy-2,6-diphenyl-1,2,5,6-tetrahydropyridine-3-carboxylate |
| Authors of publication |
Aridoss, G.; Sundaramoorthy, S.; Velmurugan, D.; Jeong, Y. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
3 |
| Pages of publication |
o540 |
| a |
8.2784 ± 0.0007 Å |
| b |
10.6116 ± 0.0009 Å |
| c |
12.7572 ± 0.0011 Å |
| α |
85.681 ± 0.004° |
| β |
89.963 ± 0.004° |
| γ |
82.508 ± 0.005° |
| Cell volume |
1107.91 ± 0.16 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0592 |
| Residual factor for significantly intense reflections |
0.0429 |
| Weighted residual factors for significantly intense reflections |
0.1082 |
| Weighted residual factors for all reflections included in the refinement |
0.1196 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229416.html