Information card for entry 2229428
| Chemical name |
3,3'-Dimethoxy-2,2'-[(4,5-dimethyl-<i>o</i>-phenylene)bis(nitrilomethanylylidene)]diphenol |
| Formula |
C24 H24 N2 O4 |
| Calculated formula |
C24 H24 N2 O4 |
| SMILES |
COc1cccc(c1/C=N/c1cc(C)c(cc1/N=C/c1c(O)cccc1OC)C)O |
| Title of publication |
3,3'-Dimethoxy-2,2'-[(4,5-dimethyl-<i>o</i>-phenylene)bis(nitrilomethanylylidene)]diphenol |
| Authors of publication |
Sahraei, Atefeh; Kargar, Hadi; Kia, Reza; Khan, Islam Ullah |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
3 |
| Pages of publication |
o636 |
| a |
8.0311 ± 0.0002 Å |
| b |
12.5836 ± 0.0003 Å |
| c |
20.6174 ± 0.0005 Å |
| α |
86.9 ± 0.001° |
| β |
82.549 ± 0.001° |
| γ |
81.806 ± 0.001° |
| Cell volume |
2043.57 ± 0.09 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1062 |
| Residual factor for significantly intense reflections |
0.0529 |
| Weighted residual factors for significantly intense reflections |
0.1211 |
| Weighted residual factors for all reflections included in the refinement |
0.1491 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.009 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229428.html