Information card for entry 2229440
| Common name |
1,4-Bis[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-ylsulfanyl]butane |
| Chemical name |
4-{5-[(4-{[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}butyl)sulfanyl]- 1,3,4-oxadiazol-2-yl}pyridine |
| Formula |
C18 H16 N6 O2 S2 |
| Calculated formula |
C18 H16 N6 O2 S2 |
| SMILES |
C(CSc1nnc(o1)c1ccncc1)CCSc1nnc(o1)c1ccncc1 |
| Title of publication |
1,4-Bis{[5-(pyridin-4-yl)-1,3,4-oxadiazol-2-yl]sulfanyl}butane |
| Authors of publication |
Liu, Qing-lei; Wang, Wei; Gao, Yan; Jia, Xiao-yu; Zhang, Jing-jing |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
3 |
| Pages of publication |
o740 |
| a |
4.978 ± 0.0006 Å |
| b |
5.7933 ± 0.0007 Å |
| c |
31.003 ± 0.004 Å |
| α |
90° |
| β |
92.588 ± 0.005° |
| γ |
90° |
| Cell volume |
893.19 ± 0.19 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0373 |
| Residual factor for significantly intense reflections |
0.0322 |
| Weighted residual factors for significantly intense reflections |
0.0856 |
| Weighted residual factors for all reflections included in the refinement |
0.0889 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229440.html