Information card for entry 2229589
| Chemical name |
5-Amino-2,4,6-triiodoisophthalic acid–4,4'-bipyridine <i>N</i>,<i>N</i>'-dioxide–water (1/1/1) |
| Formula |
C18 H14 I3 N3 O7 |
| Calculated formula |
C18 H14 I3 N3 O7 |
| SMILES |
Ic1c(C(=O)O)c(I)c(N)c(I)c1C(=O)O.O=n1ccc(cc1)c1ccn(=O)cc1.O |
| Title of publication |
5-Amino-2,4,6-triiodoisophthalic acid–4,4'-bipyridine <i>N</i>,<i>N</i>'-dioxide–water (1/1/1) |
| Authors of publication |
Zhang, Kou-Lin; Zhang, Jin-Bo; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
4 |
| Pages of publication |
o793 |
| a |
7.5 ± 0.0002 Å |
| b |
17.0808 ± 0.0004 Å |
| c |
16.523 ± 0.003 Å |
| α |
90° |
| β |
94.349 ± 0.002° |
| γ |
90° |
| Cell volume |
2110.6 ± 0.4 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0355 |
| Residual factor for significantly intense reflections |
0.0291 |
| Weighted residual factors for significantly intense reflections |
0.0631 |
| Weighted residual factors for all reflections included in the refinement |
0.0682 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229589.html